C30H29F3 — CID 77343762
1-but-2-enyl-4-[4-[4-(4-ethylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene (PubChem CID 77343762) has the molecular formula C30H29F3 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-but-2-enyl-4-[4-[4-(4-ethylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-2-enyl-4-[4-[4-(4-ethylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77343762 |
| Molecular Formula | C30H29F3 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-but-2-enyl-4-[4-[4-(4-ethylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene |
| SMILES | CC=CCc1ccc(-c2ccc(-c3ccc(C4=CCC(CC)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C30H29F3/c1-3-5-6-24-15-18-27(30(33)29(24)32)23-13-11-22(12-14-23)26-17-16-25(19-28(26)31)21-9-7-20(4-2)8-10-21/h3,5,9,11-20H,4,6-8,10H2,1-2H3 |
| InChIKey | VWESPCGSJRHXOL-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|