C29H27F3 — CID 67731705
1-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 67731705) has the molecular formula C29H27F3 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 67731705 |
| Molecular Formula | C29H27F3 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=CCCC1CC=C(c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C29H27F3/c1-3-4-5-20-7-9-22(10-8-20)25-17-15-24(18-27(25)30)21-11-13-23(14-12-21)26-16-6-19(2)28(31)29(26)32/h3,6,9,11-18,20H,1,4-5,7-8,10H2,2H3 |
| InChIKey | ZNAWWBTUIGAGGQ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|