C29H26F4O — CID 67732064
1-(4-but-3-enylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluorobenzene (PubChem CID 67732064) has the molecular formula C29H26F4O and a molecular weight of 466.52 g/mol. Its IUPAC name is 1-(4-but-3-enylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-but-3-enylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67732064 |
| Molecular Formula | C29H26F4O |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-(4-but-3-enylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluorobenzene |
| SMILES | C=CCCC1CC=C(c2ccc(-c3ccc(-c4ccc(OC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H26F4O/c1-3-4-5-18-6-8-19(9-7-18)22-14-15-23(27(31)26(22)30)20-10-12-21(13-11-20)24-16-17-25(34-2)29(33)28(24)32/h3,8,10-18H,1,4-7,9H2,2H3 |
| InChIKey | KPGHDPVRPLJFLB-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|