C36H38F4O — CID 77345864
1-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]benzene (PubChem CID 77345864) has the molecular formula C36H38F4O and a molecular weight of 562.69 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]benzene.
| Compound Name | 1-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 77345864 |
| Molecular Formula | C36H38F4O |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]benzene |
| SMILES | CC=CCCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C36H38F4O/c1-3-4-5-6-23-7-9-24(10-8-23)25-11-13-26(14-12-25)29-19-20-30(34(38)33(29)37)27-15-17-28(18-16-27)31-21-22-32(41-2)36(40)35(31)39/h3-4,13,15-25H,5-12,14H2,1-2H3 |
| InChIKey | VVGPLNQWTSSAAD-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|