C36H38BF3 — CID 88998500
CID 88998500 (PubChem CID 88998500) has the molecular formula C36H38BF3 and a molecular weight of 538.51 g/mol.
| Compound Name | CID 88998500 |
|---|---|
| PubChem CID | 88998500 |
| Molecular Formula | C36H38BF3 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CC/C=C/C)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C36H38BF3/c1-2-3-4-5-24-6-8-25(9-7-24)26-10-14-28(15-11-26)32-20-18-30(22-34(32)38)27-12-16-29(17-13-27)33-21-19-31(23-37)35(39)36(33)40/h2-3,12-14,16-22,24-26H,4-11,15,23H2,1H3/b3-2+ |
| InChIKey | SIOKQZNSEDWFAR-NSCUHMNNSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|