C41H49F3 — CID 77345743
2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-hex-3-enylbenzene (PubChem CID 77345743) has the molecular formula C41H49F3 and a molecular weight of 598.84 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-hex-3-enylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-hex-3-enylbenzene |
|---|---|
| PubChem CID | 77345743 |
| Molecular Formula | C41H49F3 |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-hex-3-enylbenzene |
| SMILES | CCC=CCCc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C41H49F3/c1-3-5-7-9-11-35-24-27-38(41(44)40(35)43)34-22-18-32(19-23-34)36-25-26-37(39(42)28-36)33-20-16-31(17-21-33)30-14-12-29(13-15-30)10-8-6-4-2/h5,7,18-20,22-31H,3-4,6,8-17,21H2,1-2H3 |
| InChIKey | NOBPKMKWKRBVGY-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|