C40H47F3O — CID 67739819
2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pent-4-enoxybenzene (PubChem CID 67739819) has the molecular formula C40H47F3O and a molecular weight of 600.81 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pent-4-enoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pent-4-enoxybenzene |
|---|---|
| PubChem CID | 67739819 |
| Molecular Formula | C40H47F3O |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pent-4-enoxybenzene |
| SMILES | C=CCCCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C40H47F3O/c1-3-5-7-9-28-10-12-29(13-11-28)30-14-18-32(19-15-30)35-23-22-34(27-37(35)41)31-16-20-33(21-17-31)36-24-25-38(40(43)39(36)42)44-26-8-6-4-2/h4,16-18,20-25,27-30H,2-3,5-15,19,26H2,1H3 |
| InChIKey | YOPFMEPUKICZPK-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|