C41H49F3O — CID 67739701
2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene (PubChem CID 67739701) has the molecular formula C41H49F3O and a molecular weight of 614.84 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene |
|---|---|
| PubChem CID | 67739701 |
| Molecular Formula | C41H49F3O |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene |
| SMILES | C/C=C/CCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OCCCCCC)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C41H49F3O/c1-3-5-7-9-27-45-39-26-25-37(40(43)41(39)44)34-21-17-32(18-22-34)35-23-24-36(38(42)28-35)33-19-15-31(16-20-33)30-13-11-29(12-14-30)10-8-6-4-2/h4,6,17-19,21-26,28-31H,3,5,7-16,20,27H2,1-2H3/b6-4+ |
| InChIKey | SIVZBCAMLHXITA-GQCTYLIASA-N |
| XLogP | 12.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|