C39H45F3O — CID 77345751
1-but-1-enoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene (PubChem CID 77345751) has the molecular formula C39H45F3O and a molecular weight of 586.78 g/mol. Its IUPAC name is 1-but-1-enoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene.
| Compound Name | 1-but-1-enoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 77345751 |
| Molecular Formula | C39H45F3O |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 1-but-1-enoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene |
| SMILES | CCC=COc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C39H45F3O/c1-3-5-7-8-27-9-11-28(12-10-27)29-13-17-31(18-14-29)34-22-21-33(26-36(34)40)30-15-19-32(20-16-30)35-23-24-37(39(42)38(35)41)43-25-6-4-2/h6,15-17,19-29H,3-5,7-14,18H2,1-2H3 |
| InChIKey | RNAKJHQXOGMJOJ-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|