C35H37F3 — CID 67739727
1-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 67739727) has the molecular formula C35H37F3 and a molecular weight of 514.68 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 67739727 |
| Molecular Formula | C35H37F3 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 1-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=CCCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(C)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C35H37F3/c1-3-4-5-24-7-9-25(10-8-24)26-11-15-28(16-12-26)31-21-19-30(22-33(31)36)27-13-17-29(18-14-27)32-20-6-23(2)34(37)35(32)38/h3,6,13-15,17-22,24-26H,1,4-5,7-12,16H2,2H3 |
| InChIKey | ZAWHHBKOHHBZPV-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|