C30H32F4 — CID 144909615
2-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3,4,5,6-tetrafluoro-7-methyl-9H-fluorene (PubChem CID 144909615) has the molecular formula C30H32F4 and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3,4,5,6-tetrafluoro-7-methyl-9H-fluorene.
| Compound Name | 2-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3,4,5,6-tetrafluoro-7-methyl-9H-fluorene |
|---|---|
| PubChem CID | 144909615 |
| Molecular Formula | C30H32F4 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-3,4,5,6-tetrafluoro-7-methyl-9H-fluorene |
| SMILES | C=CCCC1CCC(C2CC=C(c3cc4c(c(F)c3F)-c3c(cc(C)c(F)c3F)C4)CC2)CC1 |
| InChI | InChI=1S/C30H32F4/c1-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)24-16-23-15-22-14-17(2)27(31)29(33)25(22)26(23)30(34)28(24)32/h3,12,14,16,18-20H,1,4-11,13,15H2,2H3 |
| InChIKey | SSEXXMMXIHLTFW-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|