C22H28F2O — CID 89203747
4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2,3-difluorophenol (PubChem CID 89203747) has the molecular formula C22H28F2O and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2,3-difluorophenol.
| Compound Name | 4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 89203747 |
| Molecular Formula | C22H28F2O |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2,3-difluorophenol |
| SMILES | C=CCCC1CCC(C2CC=C(c3ccc(O)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H28F2O/c1-2-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19-13-14-20(25)22(24)21(19)23/h2,11,13-17,25H,1,3-10,12H2 |
| InChIKey | AFUIHGFBNSIOMN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|