C18H22F2O — CID 89203745
2,3-difluoro-4-(4-hex-5-enylcyclohexen-1-yl)phenol (PubChem CID 89203745) has the molecular formula C18H22F2O and a molecular weight of 292.37 g/mol. Its IUPAC name is 2,3-difluoro-4-(4-hex-5-enylcyclohexen-1-yl)phenol.
| Compound Name | 2,3-difluoro-4-(4-hex-5-enylcyclohexen-1-yl)phenol |
|---|---|
| PubChem CID | 89203745 |
| Molecular Formula | C18H22F2O |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2,3-difluoro-4-(4-hex-5-enylcyclohexen-1-yl)phenol |
| SMILES | C=CCCCCC1CC=C(c2ccc(O)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H22F2O/c1-2-3-4-5-6-13-7-9-14(10-8-13)15-11-12-16(21)18(20)17(15)19/h2,9,11-13,21H,1,3-8,10H2 |
| InChIKey | PKWHRBLCHRQXIZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|