C23H19F7O — CID 118592712
1-(4-but-3-enylcyclohexen-1-yl)-4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorobenzene (PubChem CID 118592712) has the molecular formula C23H19F7O and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-(4-but-3-enylcyclohexen-1-yl)-4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-but-3-enylcyclohexen-1-yl)-4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 118592712 |
| Molecular Formula | C23H19F7O |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-(4-but-3-enylcyclohexen-1-yl)-4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorobenzene |
| SMILES | C=CCCC1CC=C(c2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H19F7O/c1-2-3-4-13-5-7-14(8-6-13)16-9-10-17(21(27)20(16)26)23(29,30)31-15-11-18(24)22(28)19(25)12-15/h2,7,9-13H,1,3-6,8H2 |
| InChIKey | MEJXVMRNJVCBJH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|