C33H26F8N2O — CID 58383723
5-(4-but-3-enylcyclohexyl)-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyrimidine (PubChem CID 58383723) has the molecular formula C33H26F8N2O and a molecular weight of 618.57 g/mol. Its IUPAC name is 5-(4-but-3-enylcyclohexyl)-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyrimidine.
| Compound Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyrimidine |
|---|---|
| PubChem CID | 58383723 |
| Molecular Formula | C33H26F8N2O |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyrimidine |
| SMILES | C=CCCC1CCC(c2cnc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C33H26F8N2O/c1-2-3-4-18-5-7-19(8-6-18)22-16-42-32(43-17-22)20-9-10-24(25(34)11-20)21-12-26(35)30(27(36)13-21)33(40,41)44-23-14-28(37)31(39)29(38)15-23/h2,9-19H,1,3-8H2 |
| InChIKey | FSRSRGIPLXSCAB-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|