C33H30F8O3 — CID 59330021
5-(4-but-3-enylcyclohexyl)-2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-1,3-dioxane (PubChem CID 59330021) has the molecular formula C33H30F8O3 and a molecular weight of 626.58 g/mol. Its IUPAC name is 5-(4-but-3-enylcyclohexyl)-2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-1,3-dioxane.
| Compound Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 59330021 |
| Molecular Formula | C33H30F8O3 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-1,3-dioxane |
| SMILES | C=CCCC1CCC(C2COC(c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C33H30F8O3/c1-2-3-4-18-5-7-19(8-6-18)22-16-42-32(43-17-22)21-13-26(35)30(27(36)14-21)33(40,41)44-23-9-10-24(25(34)15-23)20-11-28(37)31(39)29(38)12-20/h2,9-15,18-19,22,32H,1,3-8,16-17H2 |
| InChIKey | HYVMPRUPJYMYJH-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|