C34H31F7N2O — CID 58383611
2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine (PubChem CID 58383611) has the molecular formula C34H31F7N2O and a molecular weight of 616.62 g/mol. Its IUPAC name is 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine.
| Compound Name | 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 58383611 |
| Molecular Formula | C34H31F7N2O |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
| SMILES | CCCCCC1CCC(c2cnc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5ccc(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C34H31F7N2O/c1-2-3-4-5-20-6-8-21(9-7-20)24-18-42-33(43-19-24)23-15-30(38)32(31(39)16-23)34(40,41)44-25-11-12-26(28(36)17-25)22-10-13-27(35)29(37)14-22/h10-21H,2-9H2,1H3 |
| InChIKey | HNHMSQWGEKDDIA-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|