C38H36F8N2O — CID 76772398
2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-3-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine (PubChem CID 76772398) has the molecular formula C38H36F8N2O and a molecular weight of 688.70 g/mol. Its IUPAC name is 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-3-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine.
| Compound Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-3-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 76772398 |
| Molecular Formula | C38H36F8N2O |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.27 |
| IUPAC Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-3-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
| SMILES | CCCCCC1CCC(c2cnc(-c3ccc(CCC=Cc4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C38H36F8N2O/c1-2-3-4-7-23-10-12-25(13-11-23)28-21-47-37(48-22-28)27-15-14-26(30(39)18-27)9-6-5-8-24-16-31(40)35(32(41)17-24)38(45,46)49-29-19-33(42)36(44)34(43)20-29/h5,8,14-23,25H,2-4,6-7,9-13H2,1H3 |
| InChIKey | RPZSOEFHAXHYPF-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|