C39H36F9NO — CID 58383697
2-[4-[(E)-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-1-enyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine (PubChem CID 58383697) has the molecular formula C39H36F9NO and a molecular weight of 705.71 g/mol. Its IUPAC name is 2-[4-[(E)-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-1-enyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine.
| Compound Name | 2-[4-[(E)-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-1-enyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
|---|---|
| PubChem CID | 58383697 |
| Molecular Formula | C39H36F9NO |
| Molecular Weight | 705.71 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | 2-[4-[(E)-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]but-1-enyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(/C=C/CCc4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C39H36F9NO/c1-2-3-4-7-23-10-12-25(13-11-23)26-14-15-36(49-22-26)27-18-30(40)29(31(41)19-27)9-6-5-8-24-16-32(42)37(33(43)17-24)39(47,48)50-28-20-34(44)38(46)35(45)21-28/h6,9,14-23,25H,2-5,7-8,10-13H2,1H3/b9-6+ |
| InChIKey | VWHXVRVRVXVKHJ-RMKNXTFCSA-N |
| XLogP | 12.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.71 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|