C38H33F9O — CID 58077516
2-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 58077516) has the molecular formula C38H33F9O and a molecular weight of 676.66 g/mol. Its IUPAC name is 2-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 2-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 58077516 |
| Molecular Formula | C38H33F9O |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 2-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C38H33F9O/c1-2-3-4-5-22-6-8-23(9-7-22)24-10-12-28(31(39)16-24)25-17-32(40)30(33(41)18-25)14-15-38(46,47)48-27-11-13-29(34(42)21-27)26-19-35(43)37(45)36(44)20-26/h10-23H,2-9H2,1H3/b15-14+ |
| InChIKey | MHQCNQBTQFEROF-CCEZHUSRSA-N |
| XLogP | 12.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|