C38H42F6O — CID 58077382
5-[4-[(E)-1,1-difluoro-3-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 58077382) has the molecular formula C38H42F6O and a molecular weight of 628.74 g/mol. Its IUPAC name is 5-[4-[(E)-1,1-difluoro-3-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[(E)-1,1-difluoro-3-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 58077382 |
| Molecular Formula | C38H42F6O |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 5-[4-[(E)-1,1-difluoro-3-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C38H42F6O/c1-2-3-4-5-25-6-10-27(11-7-25)29-14-16-30(17-15-29)28-12-8-26(9-13-28)20-21-38(43,44)45-32-18-19-33(34(39)24-32)31-22-35(40)37(42)36(41)23-31/h8-9,12-13,18-25,27,29-30H,2-7,10-11,14-17H2,1H3/b21-20+ |
| InChIKey | DEQJAZMKSKZIGC-QZQOTICOSA-N |
| XLogP | 12.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|