C28H24F6O3 — CID 58077498
2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]phenyl]-5-propyl-1,3-dioxane (PubChem CID 58077498) has the molecular formula C28H24F6O3 and a molecular weight of 522.49 g/mol. Its IUPAC name is 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]phenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]phenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 58077498 |
| Molecular Formula | C28H24F6O3 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]phenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(c2ccc(/C=C/C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C28H24F6O3/c1-2-3-18-15-35-27(36-16-18)19-6-4-17(5-7-19)10-11-28(33,34)37-21-8-9-22(23(29)14-21)20-12-24(30)26(32)25(31)13-20/h4-14,18,27H,2-3,15-16H2,1H3/b11-10+ |
| InChIKey | AJAJENYWPMBJCM-ZHACJKMWSA-N |
| XLogP | 8.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|