C35H33F6NO — CID 58383432
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyridine (PubChem CID 58383432) has the molecular formula C35H33F6NO and a molecular weight of 597.64 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyridine.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
|---|---|
| PubChem CID | 58383432 |
| Molecular Formula | C35H33F6NO |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)cc4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C35H33F6NO/c1-2-3-4-5-22-6-8-23(9-7-22)26-13-17-33(42-21-26)25-12-16-29(30(36)18-25)24-10-14-27(15-11-24)35(40,41)43-28-19-31(37)34(39)32(38)20-28/h10-23H,2-9H2,1H3 |
| InChIKey | JQRIKWOVZPSNKG-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|