C30H32F6O — CID 122578175
5-[difluoro-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]cyclohexyl]phenyl]methoxy]-1,2,3-trifluorobenzene (PubChem CID 122578175) has the molecular formula C30H32F6O and a molecular weight of 522.57 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]cyclohexyl]phenyl]methoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[difluoro-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]cyclohexyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 122578175 |
| Molecular Formula | C30H32F6O |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]cyclohexyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
| SMILES | C/C=C/CCC1CC=C(C2CCC(c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H32F6O/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-15-25(26(31)16-23)30(35,36)37-24-17-27(32)29(34)28(33)18-24/h2-3,8,14-19,21-22H,4-7,9-13H2,1H3/b3-2+ |
| InChIKey | UIYBTMFHMKFERB-NSCUHMNNSA-N |
| XLogP | 9.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|