C22H24F4 — CID 139856609
1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-(trifluoromethyl)naphthalene (PubChem CID 139856609) has the molecular formula C22H24F4 and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-(trifluoromethyl)naphthalene.
| Compound Name | 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856609 |
| Molecular Formula | C22H24F4 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-(trifluoromethyl)naphthalene |
| SMILES | C/C=C/CCC1CCC(c2ccc3c(F)c(C(F)(F)F)ccc3c2)CC1 |
| InChI | InChI=1S/C22H24F4/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-12-19-18(14-17)11-13-20(21(19)23)22(24,25)26/h2-3,10-16H,4-9H2,1H3/b3-2+ |
| InChIKey | XHPBTFDZZUVETO-NSCUHMNNSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|