C25H30F2 — CID 139863275
7-(4-but-3-enylcyclohexyl)-1,2-difluoro-3-[(E)-pent-3-enyl]naphthalene (PubChem CID 139863275) has the molecular formula C25H30F2 and a molecular weight of 368.51 g/mol. Its IUPAC name is 7-(4-but-3-enylcyclohexyl)-1,2-difluoro-3-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 7-(4-but-3-enylcyclohexyl)-1,2-difluoro-3-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139863275 |
| Molecular Formula | C25H30F2 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 7-(4-but-3-enylcyclohexyl)-1,2-difluoro-3-[(E)-pent-3-enyl]naphthalene |
| SMILES | C=CCCC1CCC(c2ccc3cc(CC/C=C/C)c(F)c(F)c3c2)CC1 |
| InChI | InChI=1S/C25H30F2/c1-3-5-7-9-22-16-21-15-14-20(17-23(21)25(27)24(22)26)19-12-10-18(11-13-19)8-6-4-2/h3-5,14-19H,2,6-13H2,1H3/b5-3+ |
| InChIKey | JFAPSHAABIGZQD-HWKANZROSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|