C22H26F2O — CID 139860599
7-(4-but-3-enylcyclohexyl)-3-ethoxy-1,2-difluoronaphthalene (PubChem CID 139860599) has the molecular formula C22H26F2O and a molecular weight of 344.45 g/mol. Its IUPAC name is 7-(4-but-3-enylcyclohexyl)-3-ethoxy-1,2-difluoronaphthalene.
| Compound Name | 7-(4-but-3-enylcyclohexyl)-3-ethoxy-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139860599 |
| Molecular Formula | C22H26F2O |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 7-(4-but-3-enylcyclohexyl)-3-ethoxy-1,2-difluoronaphthalene |
| SMILES | C=CCCC1CCC(c2ccc3cc(OCC)c(F)c(F)c3c2)CC1 |
| InChI | InChI=1S/C22H26F2O/c1-3-5-6-15-7-9-16(10-8-15)17-11-12-18-14-20(25-4-2)22(24)21(23)19(18)13-17/h3,11-16H,1,4-10H2,2H3 |
| InChIKey | HEWJJTSDJCYAPB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|