C19H26F2O2 — CID 59203793
1-[(4-but-3-enylcyclohexyl)methoxy]-4-ethoxy-2,3-difluorobenzene (PubChem CID 59203793) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(4-but-3-enylcyclohexyl)methoxy]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[(4-but-3-enylcyclohexyl)methoxy]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 59203793 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[(4-but-3-enylcyclohexyl)methoxy]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C=CCCC1CCC(COc2ccc(OCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H26F2O2/c1-3-5-6-14-7-9-15(10-8-14)13-23-17-12-11-16(22-4-2)18(20)19(17)21/h3,11-12,14-15H,1,4-10,13H2,2H3 |
| InChIKey | GZUNTHIEKFMEEV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|