C27H26F6O3 — CID 88552692
(7-ethoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl) 4-but-3-enylcyclohexane-1-carboxylate (PubChem CID 88552692) has the molecular formula C27H26F6O3 and a molecular weight of 512.49 g/mol. Its IUPAC name is (7-ethoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl) 4-but-3-enylcyclohexane-1-carboxylate.
| Compound Name | (7-ethoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl) 4-but-3-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88552692 |
| Molecular Formula | C27H26F6O3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | (7-ethoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl) 4-but-3-enylcyclohexane-1-carboxylate |
| SMILES | C=CCCC1CCC(C(=O)Oc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(OCC)c2F)CC1 |
| InChI | InChI=1S/C27H26F6O3/c1-3-5-6-15-7-9-16(10-8-15)25(34)36-20-14-12-18-17-11-13-19(35-4-2)23(28)21(17)26(30,31)27(32,33)22(18)24(20)29/h3,11-16H,1,4-10H2,2H3 |
| InChIKey | UQEZAHDEHUXTMO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|