C21H26F2O3 — CID 90161487
[2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate (PubChem CID 90161487) has the molecular formula C21H26F2O3 and a molecular weight of 364.43 g/mol. Its IUPAC name is [2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90161487 |
| Molecular Formula | C21H26F2O3 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCC1CCC(C(=O)Oc2ccc(O/C=C/C)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H26F2O3/c1-3-5-6-7-15-8-10-16(11-9-15)21(24)26-18-13-12-17(25-14-4-2)19(22)20(18)23/h3-5,12-16H,6-11H2,1-2H3/b5-3+,14-4+ |
| InChIKey | IMKBMARNSHDWRT-BTCBSJLRSA-N |
| XLogP | 5.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|