C28H28F6O3 — CID 88552697
2-[cyclopropylidene-(4-ethoxycyclohexyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene (PubChem CID 88552697) has the molecular formula C28H28F6O3 and a molecular weight of 526.52 g/mol. Its IUPAC name is 2-[cyclopropylidene-(4-ethoxycyclohexyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene.
| Compound Name | 2-[cyclopropylidene-(4-ethoxycyclohexyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
|---|---|
| PubChem CID | 88552697 |
| Molecular Formula | C28H28F6O3 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-[cyclopropylidene-(4-ethoxycyclohexyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
| SMILES | CCOc1ccc2c(c1F)C(F)(F)C(F)(F)c1c-2ccc(OC(=C2CC2)C2CCC(OCC)CC2)c1F |
| InChI | InChI=1S/C28H28F6O3/c1-3-35-17-9-7-16(8-10-17)26(15-5-6-15)37-21-14-12-19-18-11-13-20(36-4-2)24(29)22(18)27(31,32)28(33,34)23(19)25(21)30/h11-14,16-17H,3-10H2,1-2H3 |
| InChIKey | SIXBEPNMRXBIEV-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|