C22H22F4O2 — CID 163497672
4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenol (PubChem CID 163497672) has the molecular formula C22H22F4O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is 4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenol.
| Compound Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 163497672 |
| Molecular Formula | C22H22F4O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenol |
| SMILES | CCOc1ccc(C2CCC3C(c4ccc(O)c(F)c4F)CCC23)c(F)c1F |
| InChI | InChI=1S/C22H22F4O2/c1-2-28-18-10-8-16(20(24)22(18)26)14-6-4-11-12(14)3-5-13(11)15-7-9-17(27)21(25)19(15)23/h7-14,27H,2-6H2,1H3 |
| InChIKey | CSCAWCFPDNBHNG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |