C26H30F4O2 — CID 71004190
1-[4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol (PubChem CID 71004190) has the molecular formula C26H30F4O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-[4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol.
| Compound Name | 1-[4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol |
|---|---|
| PubChem CID | 71004190 |
| Molecular Formula | C26H30F4O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[4-[4-(4-ethoxy-2,3-difluorophenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C2CCC3C(c4ccc(OCC)c(F)c4F)CCC23)c(F)c1F |
| InChI | InChI=1S/C26H30F4O2/c1-3-5-21(31)20-11-10-18(23(27)25(20)29)16-8-6-15-14(16)7-9-17(15)19-12-13-22(32-4-2)26(30)24(19)28/h10-17,21,31H,3-9H2,1-2H3 |
| InChIKey | NDRVIFMKTVMDIP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |