C26H26F4O2 — CID 71004178
1-[4-[(3aR,6aR)-4-(4-ethoxy-2,3-difluorophenyl)-3,3a,6,6a-tetrahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol (PubChem CID 71004178) has the molecular formula C26H26F4O2 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-[4-[(3aR,6aR)-4-(4-ethoxy-2,3-difluorophenyl)-3,3a,6,6a-tetrahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol.
| Compound Name | 1-[4-[(3aR,6aR)-4-(4-ethoxy-2,3-difluorophenyl)-3,3a,6,6a-tetrahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol |
|---|---|
| PubChem CID | 71004178 |
| Molecular Formula | C26H26F4O2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[4-[(3aR,6aR)-4-(4-ethoxy-2,3-difluorophenyl)-3,3a,6,6a-tetrahydropentalen-1-yl]-2,3-difluorophenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C2=CC[C@H]3C(c4ccc(OCC)c(F)c4F)=CC[C@@H]23)c(F)c1F |
| InChI | InChI=1S/C26H26F4O2/c1-3-5-21(31)20-11-10-18(23(27)25(20)29)16-8-6-15-14(16)7-9-17(15)19-12-13-22(32-4-2)26(30)24(19)28/h8-15,21,31H,3-7H2,1-2H3/t14-,15-,21?/m1/s1 |
| InChIKey | XGWIYUAATORTQF-CETIQBBDSA-N |
| XLogP | 6.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |