C25H29F3O3 — CID 88977703
1-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]methoxy]phenyl]butan-1-ol (PubChem CID 88977703) has the molecular formula C25H29F3O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]methoxy]phenyl]butan-1-ol.
| Compound Name | 1-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]methoxy]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 88977703 |
| Molecular Formula | C25H29F3O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]methoxy]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(OCC2CCC(c3ccc(C4CO4)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C25H29F3O3/c1-2-3-21(29)19-10-11-22(25(28)24(19)27)30-13-15-4-6-16(7-5-15)17-8-9-18(20(26)12-17)23-14-31-23/h8-12,15-16,21,23,29H,2-7,13-14H2,1H3 |
| InChIKey | AVKRFTBCCFPBOE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|