C36H48F2O2 — CID 88561973
1-[4-[4-[3-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]cyclohexyl]cyclohexyl]butan-1-ol (PubChem CID 88561973) has the molecular formula C36H48F2O2 and a molecular weight of 550.77 g/mol. Its IUPAC name is 1-[4-[4-[3-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]cyclohexyl]cyclohexyl]butan-1-ol.
| Compound Name | 1-[4-[4-[3-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]cyclohexyl]cyclohexyl]butan-1-ol |
|---|---|
| PubChem CID | 88561973 |
| Molecular Formula | C36H48F2O2 |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 1-[4-[4-[3-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]cyclohexyl]cyclohexyl]butan-1-ol |
| SMILES | CCCC(O)C1CCC(C2CCC(c3ccc(C4CCC(c5ccc(C6CO6)c(F)c5)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C36H48F2O2/c1-2-3-35(39)28-14-10-24(11-15-28)23-4-6-25(7-5-23)29-16-18-31(33(37)20-29)27-12-8-26(9-13-27)30-17-19-32(34(38)21-30)36-22-40-36/h16-21,23-28,35-36,39H,2-15,22H2,1H3 |
| InChIKey | CTLQGDHWLNTXRZ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|