C32H32F4O2 — CID 88964167
1-[4-[4-[4-[(E)-2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]butan-1-ol (PubChem CID 88964167) has the molecular formula C32H32F4O2 and a molecular weight of 524.60 g/mol. Its IUPAC name is 1-[4-[4-[4-[(E)-2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]butan-1-ol.
| Compound Name | 1-[4-[4-[4-[(E)-2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]butan-1-ol |
|---|---|
| PubChem CID | 88964167 |
| Molecular Formula | C32H32F4O2 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[4-[4-[4-[(E)-2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]butan-1-ol |
| SMILES | CCCC(O)C1CCC(c2ccc(-c3ccc(/C=C/c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C32H32F4O2/c1-2-3-27(37)22-12-10-21(11-13-22)25-17-16-24(30(34)31(25)35)20-7-4-19(5-8-20)6-9-23-14-15-26(28-18-38-28)32(36)29(23)33/h4-9,14-17,21-22,27-28,37H,2-3,10-13,18H2,1H3/b9-6+ |
| InChIKey | OFPZYJTYYDOPCK-RMKNXTFCSA-N |
| XLogP | 8.59 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|