C30H21F3O — CID 89124727
2-[4-[4-[(E)-2-[4-(4-ethenylphenyl)-2,3-difluorophenyl]ethenyl]phenyl]-2-fluorophenyl]oxirane (PubChem CID 89124727) has the molecular formula C30H21F3O and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-[4-[4-[(E)-2-[4-(4-ethenylphenyl)-2,3-difluorophenyl]ethenyl]phenyl]-2-fluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[(E)-2-[4-(4-ethenylphenyl)-2,3-difluorophenyl]ethenyl]phenyl]-2-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 89124727 |
| Molecular Formula | C30H21F3O |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[4-[4-[(E)-2-[4-(4-ethenylphenyl)-2,3-difluorophenyl]ethenyl]phenyl]-2-fluorophenyl]oxirane |
| SMILES | C=Cc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(C5CO5)c(F)c4)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H21F3O/c1-2-19-3-10-22(11-4-19)25-15-13-23(29(32)30(25)33)12-7-20-5-8-21(9-6-20)24-14-16-26(27(31)17-24)28-18-34-28/h2-17,28H,1,18H2/b12-7+ |
| InChIKey | PRWCNIMZBMOUKT-KPKJPENVSA-N |
| XLogP | 8.32 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|