C31H22F4O — CID 89124530
2-[4-[4-[(E)-2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]phenyl]ethenyl]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 89124530) has the molecular formula C31H22F4O and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-[4-[4-[(E)-2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]phenyl]ethenyl]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[(E)-2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]phenyl]ethenyl]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 89124530 |
| Molecular Formula | C31H22F4O |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[4-[4-[(E)-2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]phenyl]ethenyl]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | C/C=C/c1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H22F4O/c1-2-3-19-4-9-21(10-5-19)24-15-14-23(28(32)29(24)33)13-8-20-6-11-22(12-7-20)25-16-17-26(27-18-36-27)31(35)30(25)34/h2-17,27H,18H2,1H3/b3-2+,13-8+ |
| InChIKey | GKYJXBFSUYQKRC-KFKHOQBUSA-N |
| XLogP | 8.85 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|