C24H14F4O — CID 88997577
2-[4-[4-[2-(4-ethenyl-2,3-difluorophenyl)ethynyl]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88997577) has the molecular formula C24H14F4O and a molecular weight of 394.37 g/mol. Its IUPAC name is 2-[4-[4-[2-(4-ethenyl-2,3-difluorophenyl)ethynyl]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[2-(4-ethenyl-2,3-difluorophenyl)ethynyl]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88997577 |
| Molecular Formula | C24H14F4O |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-[4-[4-[2-(4-ethenyl-2,3-difluorophenyl)ethynyl]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | C=Cc1ccc(C#Cc2ccc(-c3ccc(C4CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C24H14F4O/c1-2-15-9-10-17(22(26)21(15)25)8-5-14-3-6-16(7-4-14)18-11-12-19(20-13-29-20)24(28)23(18)27/h2-4,6-7,9-12,20H,1,13H2 |
| InChIKey | ZRDCUUZOOMGSIR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|