[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid

C14H11BF2O3 — CID 89045870

IUPAC[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid
SMILESOB(O)c1ccc(-c2ccc(C3CO3)c(F)c2F)cc1
InChIInChI=1S/C14H11BF2O3/c16-13-10(5-6-11(14(13)17)12-7-20-12)8-1-3-9(4-2-8)15(18)19/h1-6,12,18-19H,7H2
InChIKeyHOXVZZQRKZBOFW-UHFFFAOYSA-N
MW276.05 g/mol
LogP1.38
Rot. Bonds3

About [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid

[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid (PubChem CID 89045870) has the molecular formula C14H11BF2O3 and a molecular weight of 276.05 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid.

Molecular Properties

Compound Name[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid
PubChem CID89045870
Molecular FormulaC14H11BF2O3
Molecular Weight276.05 g/mol
Exact Mass276.08
IUPAC Name[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid
SMILESOB(O)c1ccc(-c2ccc(C3CO3)c(F)c2F)cc1
InChIInChI=1S/C14H11BF2O3/c16-13-10(5-6-11(14(13)17)12-7-20-12)8-1-3-9(4-2-8)15(18)19/h1-6,12,18-19H,7H2
InChIKeyHOXVZZQRKZBOFW-UHFFFAOYSA-N
XLogP1.38
TPSA52.99 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.05
LogP ≤ 51.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid?
The IUPAC name of [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid (CID 89045870) is [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid.
What is the SMILES notation for [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid?
The canonical SMILES for [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid is OB(O)c1ccc(-c2ccc(C3CO3)c(F)c2F)cc1.
What is the InChIKey of [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid?
The InChIKey is HOXVZZQRKZBOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BF2O3/c16-13-10(5-6-11(14(13)17)12-7-20-12)8-1-3-9(4-2-8)15(18)19/h1-6,12,18-19H,7H2.
What are the key properties of [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid?
[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid has a molecular weight of 276.05 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid is sourced from PubChem (CID 89045870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).