C14H11BF2O3 — CID 89045870
[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid (PubChem CID 89045870) has the molecular formula C14H11BF2O3 and a molecular weight of 276.05 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid.
| Compound Name | [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 89045870 |
| Molecular Formula | C14H11BF2O3 |
| Molecular Weight | 276.05 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2ccc(C3CO3)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H11BF2O3/c16-13-10(5-6-11(14(13)17)12-7-20-12)8-1-3-9(4-2-8)15(18)19/h1-6,12,18-19H,7H2 |
| InChIKey | HOXVZZQRKZBOFW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.05 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|