C28H20F4O3 — CID 88963639
2-[4-[4-[[2,3-difluoro-4-(4-methoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88963639) has the molecular formula C28H20F4O3 and a molecular weight of 480.46 g/mol. Its IUPAC name is 2-[4-[4-[[2,3-difluoro-4-(4-methoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[[2,3-difluoro-4-(4-methoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88963639 |
| Molecular Formula | C28H20F4O3 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-[4-[4-[[2,3-difluoro-4-(4-methoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | COc1ccc(-c2ccc(COc3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H20F4O3/c1-33-19-7-2-16(3-8-19)21-11-6-18(25(29)26(21)30)14-34-20-9-4-17(5-10-20)22-12-13-23(24-15-35-24)28(32)27(22)31/h2-13,24H,14-15H2,1H3 |
| InChIKey | SARSFVCNIZDIAJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|