C29H29BF4O2 — CID 88998312
CID 88998312 (PubChem CID 88998312) has the molecular formula C29H29BF4O2 and a molecular weight of 496.35 g/mol.
| Compound Name | CID 88998312 |
|---|---|
| PubChem CID | 88998312 |
| Molecular Formula | C29H29BF4O2 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | — |
| SMILES | [B]CC1CCC(c2ccc(-c3ccc(-c4ccc(COCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C29H29BF4O2/c1-2-3-14-35-17-21-9-10-22(27(32)26(21)31)19-5-7-20(8-6-19)23-11-12-24(29(34)28(23)33)25-13-4-18(15-30)16-36-25/h5-12,18,25H,2-4,13-17H2,1H3 |
| InChIKey | BTMFPPOCDXLBEU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|