C29H29F3O3 — CID 88964025
1-[4-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]phenoxy]methyl]phenyl]cyclohexyl]ethanol (PubChem CID 88964025) has the molecular formula C29H29F3O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]phenoxy]methyl]phenyl]cyclohexyl]ethanol.
| Compound Name | 1-[4-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]phenoxy]methyl]phenyl]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 88964025 |
| Molecular Formula | C29H29F3O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[[4-[3-fluoro-4-(oxiran-2-yl)phenyl]phenoxy]methyl]phenyl]cyclohexyl]ethanol |
| SMILES | CC(O)C1CCC(c2ccc(COc3ccc(-c4ccc(C5CO5)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H29F3O3/c1-17(33)18-2-4-20(5-3-18)24-12-9-22(28(31)29(24)32)15-34-23-10-6-19(7-11-23)21-8-13-25(26(30)14-21)27-16-35-27/h6-14,17-18,20,27,33H,2-5,15-16H2,1H3 |
| InChIKey | LCTBRRYBFJECER-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|