C29H27F5O3 — CID 88967669
1-[4-[4-[4-[[2,3-difluoro-4-(oxiran-2-yl)phenyl]methoxy]-2-fluorophenyl]cyclohexyl]-2,3-difluorophenyl]ethanol (PubChem CID 88967669) has the molecular formula C29H27F5O3 and a molecular weight of 518.52 g/mol. Its IUPAC name is 1-[4-[4-[4-[[2,3-difluoro-4-(oxiran-2-yl)phenyl]methoxy]-2-fluorophenyl]cyclohexyl]-2,3-difluorophenyl]ethanol.
| Compound Name | 1-[4-[4-[4-[[2,3-difluoro-4-(oxiran-2-yl)phenyl]methoxy]-2-fluorophenyl]cyclohexyl]-2,3-difluorophenyl]ethanol |
|---|---|
| PubChem CID | 88967669 |
| Molecular Formula | C29H27F5O3 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 1-[4-[4-[4-[[2,3-difluoro-4-(oxiran-2-yl)phenyl]methoxy]-2-fluorophenyl]cyclohexyl]-2,3-difluorophenyl]ethanol |
| SMILES | CC(O)c1ccc(C2CCC(c3ccc(OCc4ccc(C5CO5)c(F)c4F)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C29H27F5O3/c1-15(35)20-10-11-22(28(33)27(20)32)17-4-2-16(3-5-17)21-9-7-19(12-24(21)30)36-13-18-6-8-23(25-14-37-25)29(34)26(18)31/h6-12,15-17,25,35H,2-5,13-14H2,1H3 |
| InChIKey | NXQDXKNODUSMPA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|