C24H25F3O2 — CID 88977624
1-[2,3-difluoro-4-[(E)-2-[4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethenyl]phenyl]ethanol (PubChem CID 88977624) has the molecular formula C24H25F3O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[(E)-2-[4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethenyl]phenyl]ethanol.
| Compound Name | 1-[2,3-difluoro-4-[(E)-2-[4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 88977624 |
| Molecular Formula | C24H25F3O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[2,3-difluoro-4-[(E)-2-[4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethenyl]phenyl]ethanol |
| SMILES | CC(O)c1ccc(/C=C/C2CCC(c3ccc(C4CO4)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C24H25F3O2/c1-14(28)19-10-8-17(23(26)24(19)27)7-4-15-2-5-16(6-3-15)20-11-9-18(12-21(20)25)22-13-29-22/h4,7-12,14-16,22,28H,2-3,5-6,13H2,1H3/b7-4+ |
| InChIKey | WEABLGJIUOOEGO-QPJJXVBHSA-N |
| XLogP | 6.22 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|