C27H33F3O — CID 58141647
1-[(E)-2-[4-(4-ethoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-pentylbenzene (PubChem CID 58141647) has the molecular formula C27H33F3O and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-ethoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-pentylbenzene.
| Compound Name | 1-[(E)-2-[4-(4-ethoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 58141647 |
| Molecular Formula | C27H33F3O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-[(E)-2-[4-(4-ethoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(/C=C/C2CCC(c3ccc(OCC)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C27H33F3O/c1-3-5-6-7-21-14-15-22(27(30)26(21)29)13-10-19-8-11-20(12-9-19)24-17-16-23(31-4-2)18-25(24)28/h10,13-20H,3-9,11-12H2,1-2H3/b13-10+ |
| InChIKey | LDYUPJCIMOJVND-JLHYYAGUSA-N |
| XLogP | 8.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|