C33H37F3O2 — CID 89430983
1-[4-[(E)-2-(4-butoxy-2-fluorophenyl)ethenyl]cyclohexyl]-2,3-difluoro-4-(4-propoxyphenyl)benzene (PubChem CID 89430983) has the molecular formula C33H37F3O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-[4-[(E)-2-(4-butoxy-2-fluorophenyl)ethenyl]cyclohexyl]-2,3-difluoro-4-(4-propoxyphenyl)benzene.
| Compound Name | 1-[4-[(E)-2-(4-butoxy-2-fluorophenyl)ethenyl]cyclohexyl]-2,3-difluoro-4-(4-propoxyphenyl)benzene |
|---|---|
| PubChem CID | 89430983 |
| Molecular Formula | C33H37F3O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 1-[4-[(E)-2-(4-butoxy-2-fluorophenyl)ethenyl]cyclohexyl]-2,3-difluoro-4-(4-propoxyphenyl)benzene |
| SMILES | CCCCOc1ccc(/C=C/C2CCC(c3ccc(-c4ccc(OCCC)cc4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C33H37F3O2/c1-3-5-21-38-28-17-14-26(31(34)22-28)11-8-23-6-9-24(10-7-23)29-18-19-30(33(36)32(29)35)25-12-15-27(16-13-25)37-20-4-2/h8,11-19,22-24H,3-7,9-10,20-21H2,1-2H3/b11-8+ |
| InChIKey | DDKAFNJEBIOMLI-DHZHZOJOSA-N |
| XLogP | 9.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|