C33H39F3O2 — CID 89430400
1-[4-[2-(4-butoxy-2-fluorophenyl)ethyl]phenyl]-2,3-difluoro-4-(4-propoxycyclohexyl)benzene (PubChem CID 89430400) has the molecular formula C33H39F3O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 1-[4-[2-(4-butoxy-2-fluorophenyl)ethyl]phenyl]-2,3-difluoro-4-(4-propoxycyclohexyl)benzene.
| Compound Name | 1-[4-[2-(4-butoxy-2-fluorophenyl)ethyl]phenyl]-2,3-difluoro-4-(4-propoxycyclohexyl)benzene |
|---|---|
| PubChem CID | 89430400 |
| Molecular Formula | C33H39F3O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 1-[4-[2-(4-butoxy-2-fluorophenyl)ethyl]phenyl]-2,3-difluoro-4-(4-propoxycyclohexyl)benzene |
| SMILES | CCCCOc1ccc(CCc2ccc(-c3ccc(C4CCC(OCCC)CC4)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C33H39F3O2/c1-3-5-21-38-28-17-14-26(31(34)22-28)11-8-23-6-9-24(10-7-23)29-18-19-30(33(36)32(29)35)25-12-15-27(16-13-25)37-20-4-2/h6-7,9-10,14,17-19,22,25,27H,3-5,8,11-13,15-16,20-21H2,1-2H3 |
| InChIKey | SAJHJZNERLABDJ-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|