C33H45F3O3 — CID 89430216
1-(4-butoxycyclohexyl)-4-[4-[(4-butoxy-2-fluorophenyl)methoxy]cyclohexyl]-2,3-difluorobenzene (PubChem CID 89430216) has the molecular formula C33H45F3O3 and a molecular weight of 546.71 g/mol. Its IUPAC name is 1-(4-butoxycyclohexyl)-4-[4-[(4-butoxy-2-fluorophenyl)methoxy]cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butoxycyclohexyl)-4-[4-[(4-butoxy-2-fluorophenyl)methoxy]cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430216 |
| Molecular Formula | C33H45F3O3 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 1-(4-butoxycyclohexyl)-4-[4-[(4-butoxy-2-fluorophenyl)methoxy]cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(COC2CCC(c3ccc(C4CCC(OCCCC)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C33H45F3O3/c1-3-5-19-37-26-12-7-23(8-13-26)29-17-18-30(33(36)32(29)35)24-9-14-27(15-10-24)39-22-25-11-16-28(21-31(25)34)38-20-6-4-2/h11,16-18,21,23-24,26-27H,3-10,12-15,19-20,22H2,1-2H3 |
| InChIKey | ZBUMMBWNQGCTLZ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|